C29H38O2 — CID 101352806
(2E,4E,6E,8E,10E,12E,14S,16S)-10,14,16-trimethyl-12-(phenylmethoxymethyl)octadeca-2,4,6,8,10,12-hexaenal (PubChem CID 101352806) has the molecular formula C29H38O2 and a molecular weight of 418.62 g/mol. Its IUPAC name is (2E,4E,6E,8E,10E,12E,14S,16S)-10,14,16-trimethyl-12-(phenylmethoxymethyl)octadeca-2,4,6,8,10,12-hexaenal.
| Compound Name | (2E,4E,6E,8E,10E,12E,14S,16S)-10,14,16-trimethyl-12-(phenylmethoxymethyl)octadeca-2,4,6,8,10,12-hexaenal |
|---|---|
| PubChem CID | 101352806 |
| Molecular Formula | C29H38O2 |
| Molecular Weight | 418.62 g/mol |
| Exact Mass | 418.29 |
| IUPAC Name | (2E,4E,6E,8E,10E,12E,14S,16S)-10,14,16-trimethyl-12-(phenylmethoxymethyl)octadeca-2,4,6,8,10,12-hexaenal |
| SMILES | CC[C@H](C)C[C@H](C)/C=C(\C=C(C)\C=C\C=C\C=C\C=C\C=O)COCc1ccccc1 |
| InChI | InChI=1S/C29H38O2/c1-5-25(2)20-27(4)22-29(24-31-23-28-17-13-11-14-18-28)21-26(3)16-12-9-7-6-8-10-15-19-30/h6-19,21-22,25,27H,5,20,23-24H2,1-4H3/b8-6+,9-7+,15-10+,16-12+,26-21+,29-22+/t25-,27-/m0/s1 |
| InChIKey | VCUOZPMSKHHVMW-VZXAKELVSA-N |
| XLogP | 7.57 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.62 |
| LogP ≤ 5 | 7.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|