C21H27N2O4+ — CID 101352948
(1S,10R,12S,13E,18S)-13-ethylidene-10-hydroxy-18-(hydroxymethyl)-15-methyl-8-aza-15-azoniapentacyclo[10.5.1.01,9.02,7.09,15]octadeca-2,4,6-triene-18-carboxylic acid (PubChem CID 101352948) has the molecular formula C21H27N2O4+ and a molecular weight of 371.46 g/mol. Its IUPAC name is (1S,10R,12S,13E,18S)-13-ethylidene-10-hydroxy-18-(hydroxymethyl)-15-methyl-8-aza-15-azoniapentacyclo[10.5.1.01,9.02,7.09,15]octadeca-2,4,6-triene-18-carboxylic acid.
| Compound Name | (1S,10R,12S,13E,18S)-13-ethylidene-10-hydroxy-18-(hydroxymethyl)-15-methyl-8-aza-15-azoniapentacyclo[10.5.1.01,9.02,7.09,15]octadeca-2,4,6-triene-18-carboxylic acid |
|---|---|
| PubChem CID | 101352948 |
| Molecular Formula | C21H27N2O4+ |
| Molecular Weight | 371.46 g/mol |
| Exact Mass | 371.20 |
| IUPAC Name | (1S,10R,12S,13E,18S)-13-ethylidene-10-hydroxy-18-(hydroxymethyl)-15-methyl-8-aza-15-azoniapentacyclo[10.5.1.01,9.02,7.09,15]octadeca-2,4,6-triene-18-carboxylic acid |
| SMILES | C/C=C1/C[N+]2(C)CC[C@@]34c5ccccc5NC32C(O)C[C@@H]1[C@]4(CO)C(=O)O |
| InChI | InChI=1S/C21H26N2O4/c1-3-13-11-23(2)9-8-20-14-6-4-5-7-16(14)22-21(20,23)17(25)10-15(13)19(20,12-24)18(26)27/h3-7,15,17,22,24-25H,8-12H2,1-2H3/p+1/b13-3-/t15-,17?,19+,20-,21?,23?/m0/s1 |
| InChIKey | AHPUGTDAOMLACC-IXAAWVDSSA-O |
| XLogP | 1.30 |
| TPSA | 89.79 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.46 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|