C15H14Cl2N2 — CID 101353548
3-(dichloromethyl)-2-methyl-5-naphthalen-2-yl-3,4-dihydropyrazole (PubChem CID 101353548) has the molecular formula C15H14Cl2N2 and a molecular weight of 293.20 g/mol. Its IUPAC name is 3-(dichloromethyl)-2-methyl-5-naphthalen-2-yl-3,4-dihydropyrazole.
| Compound Name | 3-(dichloromethyl)-2-methyl-5-naphthalen-2-yl-3,4-dihydropyrazole |
|---|---|
| PubChem CID | 101353548 |
| Molecular Formula | C15H14Cl2N2 |
| Molecular Weight | 293.20 g/mol |
| Exact Mass | 292.05 |
| IUPAC Name | 3-(dichloromethyl)-2-methyl-5-naphthalen-2-yl-3,4-dihydropyrazole |
| SMILES | CN1N=C(c2ccc3ccccc3c2)CC1C(Cl)Cl |
| InChI | InChI=1S/C15H14Cl2N2/c1-19-14(15(16)17)9-13(18-19)12-7-6-10-4-2-3-5-11(10)8-12/h2-8,14-15H,9H2,1H3 |
| InChIKey | UOPRRCAFQRMXSY-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.20 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|