C15H15N — CID 101496554
3-methyl-5-naphthalen-2-yl-3,4-dihydro-2H-pyrrole (PubChem CID 101496554) has the molecular formula C15H15N and a molecular weight of 209.29 g/mol. Its IUPAC name is 3-methyl-5-naphthalen-2-yl-3,4-dihydro-2H-pyrrole.
| Compound Name | 3-methyl-5-naphthalen-2-yl-3,4-dihydro-2H-pyrrole |
|---|---|
| PubChem CID | 101496554 |
| Molecular Formula | C15H15N |
| Molecular Weight | 209.29 g/mol |
| Exact Mass | 209.12 |
| IUPAC Name | 3-methyl-5-naphthalen-2-yl-3,4-dihydro-2H-pyrrole |
| SMILES | CC1CN=C(c2ccc3ccccc3c2)C1 |
| InChI | InChI=1S/C15H15N/c1-11-8-15(16-10-11)14-7-6-12-4-2-3-5-13(12)9-14/h2-7,9,11H,8,10H2,1H3 |
| InChIKey | SENTYMQGFMIDCS-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.29 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |