C5H6Br2 — CID 101354603
(3S,5S)-3,5-dibromocyclopentene (PubChem CID 101354603) has the molecular formula C5H6Br2 and a molecular weight of 225.91 g/mol. Its IUPAC name is (3S,5S)-3,5-dibromocyclopentene.
| Compound Name | (3S,5S)-3,5-dibromocyclopentene |
|---|---|
| PubChem CID | 101354603 |
| Molecular Formula | C5H6Br2 |
| Molecular Weight | 225.91 g/mol |
| Exact Mass | 223.88 |
| IUPAC Name | (3S,5S)-3,5-dibromocyclopentene |
| SMILES | Br[C@@H]1C=C[C@@H](Br)C1 |
| InChI | InChI=1S/C5H6Br2/c6-4-1-2-5(7)3-4/h1-2,4-5H,3H2/t4-,5-/m1/s1 |
| InChIKey | AKAJVSSDORNOIX-RFZPGFLSSA-N |
| XLogP | 2.47 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 7 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.91 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|