C7H11Br — CID 5325852
(3R,5R)-3-bromo-5-methylcyclohexene (PubChem CID 5325852) has the molecular formula C7H11Br and a molecular weight of 175.07 g/mol. Its IUPAC name is (3R,5R)-3-bromo-5-methylcyclohexene.
| Compound Name | (3R,5R)-3-bromo-5-methylcyclohexene |
|---|---|
| PubChem CID | 5325852 |
| Molecular Formula | C7H11Br |
| Molecular Weight | 175.07 g/mol |
| Exact Mass | 174.00 |
| IUPAC Name | (3R,5R)-3-bromo-5-methylcyclohexene |
| SMILES | C[C@@H]1CC=C[C@H](Br)C1 |
| InChI | InChI=1S/C7H11Br/c1-6-3-2-4-7(8)5-6/h2,4,6-7H,3,5H2,1H3/t6-,7+/m1/s1 |
| InChIKey | ZHHONHRJGHGUHN-RQJHMYQMSA-N |
| XLogP | 2.74 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 175.07 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|