C15H22Si — CID 101414090
[(1R,5S)-1-deuterio-5-methylcyclohex-2-en-1-yl]-dimethyl-phenylsilane (PubChem CID 101414090) has the molecular formula C15H22Si and a molecular weight of 231.43 g/mol. Its IUPAC name is [(1R,5S)-1-deuterio-5-methylcyclohex-2-en-1-yl]-dimethyl-phenylsilane.
| Compound Name | [(1R,5S)-1-deuterio-5-methylcyclohex-2-en-1-yl]-dimethyl-phenylsilane |
|---|---|
| PubChem CID | 101414090 |
| Molecular Formula | C15H22Si |
| Molecular Weight | 231.43 g/mol |
| Exact Mass | 231.16 |
| IUPAC Name | [(1R,5S)-1-deuterio-5-methylcyclohex-2-en-1-yl]-dimethyl-phenylsilane |
| SMILES | [2H][C@]1([Si](C)(C)c2ccccc2)C=CC[C@H](C)C1 |
| InChI | InChI=1S/C15H22Si/c1-13-8-7-11-15(12-13)16(2,3)14-9-5-4-6-10-14/h4-7,9-11,13,15H,8,12H2,1-3H3/t13-,15-/m0/s1/i15D |
| InChIKey | ZRYAJQIYXWIPCI-LFMMGCGASA-N |
| XLogP | 3.96 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.43 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|