C10H13F5O3S — CID 101355877
ethyl 3-ethylsulfanylcarbonyl-4,4,5,5,5-pentafluoropentanoate (PubChem CID 101355877) has the molecular formula C10H13F5O3S and a molecular weight of 308.27 g/mol. Its IUPAC name is ethyl 3-ethylsulfanylcarbonyl-4,4,5,5,5-pentafluoropentanoate.
| Compound Name | ethyl 3-ethylsulfanylcarbonyl-4,4,5,5,5-pentafluoropentanoate |
|---|---|
| PubChem CID | 101355877 |
| Molecular Formula | C10H13F5O3S |
| Molecular Weight | 308.27 g/mol |
| Exact Mass | 308.05 |
| IUPAC Name | ethyl 3-ethylsulfanylcarbonyl-4,4,5,5,5-pentafluoropentanoate |
| SMILES | CCOC(=O)CC(C(=O)SCC)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C10H13F5O3S/c1-3-18-7(16)5-6(8(17)19-4-2)9(11,12)10(13,14)15/h6H,3-5H2,1-2H3 |
| InChIKey | DQQBRDUTZCSJTF-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.27 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|