C24H46O2Si — CID 101356343
(Z)-3-[[tert-butyl(dimethyl)silyl]oxymethyl]-4,4-dimethyl-1-[(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl]pent-2-en-1-one (PubChem CID 101356343) has the molecular formula C24H46O2Si and a molecular weight of 394.72 g/mol. Its IUPAC name is (Z)-3-[[tert-butyl(dimethyl)silyl]oxymethyl]-4,4-dimethyl-1-[(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl]pent-2-en-1-one.
| Compound Name | (Z)-3-[[tert-butyl(dimethyl)silyl]oxymethyl]-4,4-dimethyl-1-[(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl]pent-2-en-1-one |
|---|---|
| PubChem CID | 101356343 |
| Molecular Formula | C24H46O2Si |
| Molecular Weight | 394.72 g/mol |
| Exact Mass | 394.33 |
| IUPAC Name | (Z)-3-[[tert-butyl(dimethyl)silyl]oxymethyl]-4,4-dimethyl-1-[(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl]pent-2-en-1-one |
| SMILES | CC(C)[C@@H]1CC[C@@H](C)C[C@H]1C(=O)/C=C(\CO[Si](C)(C)C(C)(C)C)C(C)(C)C |
| InChI | InChI=1S/C24H46O2Si/c1-17(2)20-13-12-18(3)14-21(20)22(25)15-19(23(4,5)6)16-26-27(10,11)24(7,8)9/h15,17-18,20-21H,12-14,16H2,1-11H3/b19-15+/t18-,20+,21-/m1/s1 |
| InChIKey | AWZRXYOPNXZZJO-ZLYVANOUSA-N |
| XLogP | 7.26 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.72 |
| LogP ≤ 5 | 7.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|