C27H35NOSi — CID 101356412
(9aS,9bR)-2,2-bis(2,4,6-trimethylphenyl)-6,7,8,9,9a,9b-hexahydro-4H-oxasilolo[5,4-a]indolizine (PubChem CID 101356412) has the molecular formula C27H35NOSi and a molecular weight of 417.67 g/mol. Its IUPAC name is (9aS,9bR)-2,2-bis(2,4,6-trimethylphenyl)-6,7,8,9,9a,9b-hexahydro-4H-oxasilolo[5,4-a]indolizine.
| Compound Name | (9aS,9bR)-2,2-bis(2,4,6-trimethylphenyl)-6,7,8,9,9a,9b-hexahydro-4H-oxasilolo[5,4-a]indolizine |
|---|---|
| PubChem CID | 101356412 |
| Molecular Formula | C27H35NOSi |
| Molecular Weight | 417.67 g/mol |
| Exact Mass | 417.25 |
| IUPAC Name | (9aS,9bR)-2,2-bis(2,4,6-trimethylphenyl)-6,7,8,9,9a,9b-hexahydro-4H-oxasilolo[5,4-a]indolizine |
| SMILES | Cc1cc(C)c([Si]2(c3c(C)cc(C)cc3C)C=C3CN4CCCC[C@H]4[C@@H]3O2)c(C)c1 |
| InChI | InChI=1S/C27H35NOSi/c1-17-11-19(3)26(20(4)12-17)30(27-21(5)13-18(2)14-22(27)6)16-23-15-28-10-8-7-9-24(28)25(23)29-30/h11-14,16,24-25H,7-10,15H2,1-6H3/t24-,25+/m0/s1 |
| InChIKey | YXPBHGPWMIKFOW-LOSJGSFVSA-N |
| XLogP | 4.33 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.67 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|