C28H39NOSi — CID 101356410
(3aR,10aS,10bR)-2,2-bis(2,4,6-trimethylphenyl)-3,3a,4,5,7,8,9,10,10a,10b-decahydrooxasilolo[5,4-a]quinolizine (PubChem CID 101356410) has the molecular formula C28H39NOSi and a molecular weight of 433.71 g/mol. Its IUPAC name is (3aR,10aS,10bR)-2,2-bis(2,4,6-trimethylphenyl)-3,3a,4,5,7,8,9,10,10a,10b-decahydrooxasilolo[5,4-a]quinolizine.
| Compound Name | (3aR,10aS,10bR)-2,2-bis(2,4,6-trimethylphenyl)-3,3a,4,5,7,8,9,10,10a,10b-decahydrooxasilolo[5,4-a]quinolizine |
|---|---|
| PubChem CID | 101356410 |
| Molecular Formula | C28H39NOSi |
| Molecular Weight | 433.71 g/mol |
| Exact Mass | 433.28 |
| IUPAC Name | (3aR,10aS,10bR)-2,2-bis(2,4,6-trimethylphenyl)-3,3a,4,5,7,8,9,10,10a,10b-decahydrooxasilolo[5,4-a]quinolizine |
| SMILES | Cc1cc(C)c([Si]2(c3c(C)cc(C)cc3C)C[C@@H]3CCN4CCCC[C@H]4[C@@H]3O2)c(C)c1 |
| InChI | InChI=1S/C28H39NOSi/c1-18-13-20(3)27(21(4)14-18)31(28-22(5)15-19(2)16-23(28)6)17-24-10-12-29-11-8-7-9-25(29)26(24)30-31/h13-16,24-26H,7-12,17H2,1-6H3/t24-,25-,26+/m0/s1 |
| InChIKey | OVLNXQNEYDWACR-KKUQBAQOSA-N |
| XLogP | 4.87 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.71 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|