C21H33NOSi — CID 135000107
[(6E,7S,8aS)-6-benzylidene-2,3,5,7,8,8a-hexahydro-1H-indolizin-7-yl]oxy-triethylsilane (PubChem CID 135000107) has the molecular formula C21H33NOSi and a molecular weight of 343.59 g/mol. Its IUPAC name is [(6E,7S,8aS)-6-benzylidene-2,3,5,7,8,8a-hexahydro-1H-indolizin-7-yl]oxy-triethylsilane.
| Compound Name | [(6E,7S,8aS)-6-benzylidene-2,3,5,7,8,8a-hexahydro-1H-indolizin-7-yl]oxy-triethylsilane |
|---|---|
| PubChem CID | 135000107 |
| Molecular Formula | C21H33NOSi |
| Molecular Weight | 343.59 g/mol |
| Exact Mass | 343.23 |
| IUPAC Name | [(6E,7S,8aS)-6-benzylidene-2,3,5,7,8,8a-hexahydro-1H-indolizin-7-yl]oxy-triethylsilane |
| SMILES | CC[Si](CC)(CC)O[C@H]1C[C@@H]2CCCN2C/C1=C\c1ccccc1 |
| InChI | InChI=1S/C21H33NOSi/c1-4-24(5-2,6-3)23-21-16-20-13-10-14-22(20)17-19(21)15-18-11-8-7-9-12-18/h7-9,11-12,15,20-21H,4-6,10,13-14,16-17H2,1-3H3/b19-15+/t20-,21-/m0/s1 |
| InChIKey | LYIKJARIFBZASF-HAEKXNGDSA-N |
| XLogP | 5.33 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.59 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|