C11H22N2O6S2 — CID 101358586
2-methyl-1-[3-[(2-methyl-2-sulfinopropanoyl)amino]propylamino]-1-oxopropane-2-sulfinic acid (PubChem CID 101358586) has the molecular formula C11H22N2O6S2 and a molecular weight of 342.44 g/mol. Its IUPAC name is 2-methyl-1-[3-[(2-methyl-2-sulfinopropanoyl)amino]propylamino]-1-oxopropane-2-sulfinic acid.
| Compound Name | 2-methyl-1-[3-[(2-methyl-2-sulfinopropanoyl)amino]propylamino]-1-oxopropane-2-sulfinic acid |
|---|---|
| PubChem CID | 101358586 |
| Molecular Formula | C11H22N2O6S2 |
| Molecular Weight | 342.44 g/mol |
| Exact Mass | 342.09 |
| IUPAC Name | 2-methyl-1-[3-[(2-methyl-2-sulfinopropanoyl)amino]propylamino]-1-oxopropane-2-sulfinic acid |
| SMILES | CC(C)(C(=O)NCCCNC(=O)C(C)(C)S(=O)O)S(=O)O |
| InChI | InChI=1S/C11H22N2O6S2/c1-10(2,20(16)17)8(14)12-6-5-7-13-9(15)11(3,4)21(18)19/h5-7H2,1-4H3,(H,12,14)(H,13,15)(H,16,17)(H,18,19) |
| InChIKey | QGUJAFFDFARCFX-UHFFFAOYSA-N |
| XLogP | -0.39 |
| TPSA | 132.80 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.44 |
| LogP ≤ 5 | -0.39 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|