About 2-(trideuteriomethyl)-4,5-dihydro-1,3-oxazole
2-(trideuteriomethyl)-4,5-dihydro-1,3-oxazole (PubChem CID 101358673) has the molecular formula C4H7NO
and a molecular weight of 88.12 g/mol. Its IUPAC name is 2-(trideuteriomethyl)-4,5-dihydro-1,3-oxazole.
Analyze 2-(trideuteriomethyl)-4,5-dihydro-1,3-oxazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(trideuteriomethyl)-4,5-dihydro-1,3-oxazole?
The IUPAC name of 2-(trideuteriomethyl)-4,5-dihydro-1,3-oxazole (CID 101358673) is 2-(trideuteriomethyl)-4,5-dihydro-1,3-oxazole.
What is the SMILES notation for 2-(trideuteriomethyl)-4,5-dihydro-1,3-oxazole?
The canonical SMILES for 2-(trideuteriomethyl)-4,5-dihydro-1,3-oxazole is [2H]C([2H])([2H])C1=NCCO1.
What is the InChIKey of 2-(trideuteriomethyl)-4,5-dihydro-1,3-oxazole?
The InChIKey is GUXJXWKCUUWCLX-FIBGUPNXSA-N. The full InChI is InChI=1S/C4H7NO/c1-4-5-2-3-6-4/h2-3H2,1H3/i1D3.
What are the key properties of 2-(trideuteriomethyl)-4,5-dihydro-1,3-oxazole?
2-(trideuteriomethyl)-4,5-dihydro-1,3-oxazole has a molecular weight of 88.12 g/mol, XLogP of 0.44, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(trideuteriomethyl)-4,5-dihydro-1,3-oxazole is sourced from PubChem (CID 101358673), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).