C15H25NO3SSi — CID 101359717
N-[1-hydroxy-3-(trimethylsilylmethyl)but-3-en-2-yl]-4-methylbenzenesulfonamide (PubChem CID 101359717) has the molecular formula C15H25NO3SSi and a molecular weight of 327.52 g/mol. Its IUPAC name is N-[1-hydroxy-3-(trimethylsilylmethyl)but-3-en-2-yl]-4-methylbenzenesulfonamide.
| Compound Name | N-[1-hydroxy-3-(trimethylsilylmethyl)but-3-en-2-yl]-4-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 101359717 |
| Molecular Formula | C15H25NO3SSi |
| Molecular Weight | 327.52 g/mol |
| Exact Mass | 327.13 |
| IUPAC Name | N-[1-hydroxy-3-(trimethylsilylmethyl)but-3-en-2-yl]-4-methylbenzenesulfonamide |
| SMILES | C=C(C[Si](C)(C)C)C(CO)NS(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C15H25NO3SSi/c1-12-6-8-14(9-7-12)20(18,19)16-15(10-17)13(2)11-21(3,4)5/h6-9,15-17H,2,10-11H2,1,3-5H3 |
| InChIKey | ZTBOYGMWMPPQQJ-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.52 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|