C18H19NO4S — CID 101363103
[(4S,5S)-2-methyl-5-phenyl-4,5-dihydro-1,3-oxazol-4-yl]methyl 4-methylbenzenesulfonate (PubChem CID 101363103) has the molecular formula C18H19NO4S and a molecular weight of 345.42 g/mol. Its IUPAC name is [(4S,5S)-2-methyl-5-phenyl-4,5-dihydro-1,3-oxazol-4-yl]methyl 4-methylbenzenesulfonate.
| Compound Name | [(4S,5S)-2-methyl-5-phenyl-4,5-dihydro-1,3-oxazol-4-yl]methyl 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 101363103 |
| Molecular Formula | C18H19NO4S |
| Molecular Weight | 345.42 g/mol |
| Exact Mass | 345.10 |
| IUPAC Name | [(4S,5S)-2-methyl-5-phenyl-4,5-dihydro-1,3-oxazol-4-yl]methyl 4-methylbenzenesulfonate |
| SMILES | CC1=N[C@@H](COS(=O)(=O)c2ccc(C)cc2)[C@H](c2ccccc2)O1 |
| InChI | InChI=1S/C18H19NO4S/c1-13-8-10-16(11-9-13)24(20,21)22-12-17-18(23-14(2)19-17)15-6-4-3-5-7-15/h3-11,17-18H,12H2,1-2H3/t17-,18-/m0/s1 |
| InChIKey | OZXFODQRMNSTFU-ROUUACIJSA-N |
| XLogP | 3.26 |
| TPSA | 64.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.42 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|