C17H34O2Si — CID 101364444
1-[(1S,2R)-1-methyl-2-triethylsilyloxycyclopentyl]pentan-1-one (PubChem CID 101364444) has the molecular formula C17H34O2Si and a molecular weight of 298.54 g/mol. Its IUPAC name is 1-[(1S,2R)-1-methyl-2-triethylsilyloxycyclopentyl]pentan-1-one.
| Compound Name | 1-[(1S,2R)-1-methyl-2-triethylsilyloxycyclopentyl]pentan-1-one |
|---|---|
| PubChem CID | 101364444 |
| Molecular Formula | C17H34O2Si |
| Molecular Weight | 298.54 g/mol |
| Exact Mass | 298.23 |
| IUPAC Name | 1-[(1S,2R)-1-methyl-2-triethylsilyloxycyclopentyl]pentan-1-one |
| SMILES | CCCCC(=O)[C@@]1(C)CCC[C@H]1O[Si](CC)(CC)CC |
| InChI | InChI=1S/C17H34O2Si/c1-6-10-12-15(18)17(5)14-11-13-16(17)19-20(7-2,8-3)9-4/h16H,6-14H2,1-5H3/t16-,17-/m1/s1 |
| InChIKey | QZDWUWPIPGULTA-IAGOWNOFSA-N |
| XLogP | 5.33 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.54 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|