C22H23NO7 — CID 10136445
4-[2,6-dimethyl-4-[(2R,3R,4S,5R,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxybenzoyl]benzonitrile (PubChem CID 10136445) has the molecular formula C22H23NO7 and a molecular weight of 413.43 g/mol. Its IUPAC name is 4-[2,6-dimethyl-4-[(2R,3R,4S,5R,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxybenzoyl]benzonitrile.
| Compound Name | 4-[2,6-dimethyl-4-[(2R,3R,4S,5R,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxybenzoyl]benzonitrile |
|---|---|
| PubChem CID | 10136445 |
| Molecular Formula | C22H23NO7 |
| Molecular Weight | 413.43 g/mol |
| Exact Mass | 413.15 |
| IUPAC Name | 4-[2,6-dimethyl-4-[(2R,3R,4S,5R,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxybenzoyl]benzonitrile |
| SMILES | Cc1cc(O[C@H]2O[C@H](CO)[C@H](O)[C@H](O)[C@H]2O)cc(C)c1C(=O)c1ccc(C#N)cc1 |
| InChI | InChI=1S/C22H23NO7/c1-11-7-15(29-22-21(28)20(27)19(26)16(10-24)30-22)8-12(2)17(11)18(25)14-5-3-13(9-23)4-6-14/h3-8,16,19-22,24,26-28H,10H2,1-2H3/t16-,19+,20+,21-,22+/m1/s1 |
| InChIKey | MQUYGBIZADZELV-UGTAXJHQSA-N |
| XLogP | 0.58 |
| TPSA | 140.24 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.43 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |