C21H21NO7 — CID 10200932
4-[2-methyl-4-[(2R,3R,4S,5R,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxybenzoyl]benzonitrile (PubChem CID 10200932) has the molecular formula C21H21NO7 and a molecular weight of 399.40 g/mol. Its IUPAC name is 4-[2-methyl-4-[(2R,3R,4S,5R,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxybenzoyl]benzonitrile.
| Compound Name | 4-[2-methyl-4-[(2R,3R,4S,5R,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxybenzoyl]benzonitrile |
|---|---|
| PubChem CID | 10200932 |
| Molecular Formula | C21H21NO7 |
| Molecular Weight | 399.40 g/mol |
| Exact Mass | 399.13 |
| IUPAC Name | 4-[2-methyl-4-[(2R,3R,4S,5R,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxybenzoyl]benzonitrile |
| SMILES | Cc1cc(O[C@H]2O[C@H](CO)[C@H](O)[C@H](O)[C@H]2O)ccc1C(=O)c1ccc(C#N)cc1 |
| InChI | InChI=1S/C21H21NO7/c1-11-8-14(28-21-20(27)19(26)18(25)16(10-23)29-21)6-7-15(11)17(24)13-4-2-12(9-22)3-5-13/h2-8,16,18-21,23,25-27H,10H2,1H3/t16-,18+,19+,20-,21+/m1/s1 |
| InChIKey | AKQVEPSYFVEJOC-RQSWOZRGSA-N |
| XLogP | 0.28 |
| TPSA | 140.24 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.40 |
| LogP ≤ 5 | 0.28 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |