C24H35NO5S — CID 101366737
N-[(2S)-2-hydroxyoctyl]-N-[(2S)-2-hydroxy-3-phenoxypropyl]-4-methylbenzenesulfonamide (PubChem CID 101366737) has the molecular formula C24H35NO5S and a molecular weight of 449.61 g/mol. Its IUPAC name is N-[(2S)-2-hydroxyoctyl]-N-[(2S)-2-hydroxy-3-phenoxypropyl]-4-methylbenzenesulfonamide.
| Compound Name | N-[(2S)-2-hydroxyoctyl]-N-[(2S)-2-hydroxy-3-phenoxypropyl]-4-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 101366737 |
| Molecular Formula | C24H35NO5S |
| Molecular Weight | 449.61 g/mol |
| Exact Mass | 449.22 |
| IUPAC Name | N-[(2S)-2-hydroxyoctyl]-N-[(2S)-2-hydroxy-3-phenoxypropyl]-4-methylbenzenesulfonamide |
| SMILES | CCCCCC[C@H](O)CN(C[C@H](O)COc1ccccc1)S(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C24H35NO5S/c1-3-4-5-7-10-21(26)17-25(31(28,29)24-15-13-20(2)14-16-24)18-22(27)19-30-23-11-8-6-9-12-23/h6,8-9,11-16,21-22,26-27H,3-5,7,10,17-19H2,1-2H3/t21-,22-/m0/s1 |
| InChIKey | KPSMJCHYBBJNOU-VXKWHMMOSA-N |
| XLogP | 3.76 |
| TPSA | 87.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.61 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|