C8H14O4S — CID 101370662
(5S,6S)-5,6-dimethoxy-5,6-dimethyl-1,4-oxathian-2-one (PubChem CID 101370662) has the molecular formula C8H14O4S and a molecular weight of 206.26 g/mol. Its IUPAC name is (5S,6S)-5,6-dimethoxy-5,6-dimethyl-1,4-oxathian-2-one.
| Compound Name | (5S,6S)-5,6-dimethoxy-5,6-dimethyl-1,4-oxathian-2-one |
|---|---|
| PubChem CID | 101370662 |
| Molecular Formula | C8H14O4S |
| Molecular Weight | 206.26 g/mol |
| Exact Mass | 206.06 |
| IUPAC Name | (5S,6S)-5,6-dimethoxy-5,6-dimethyl-1,4-oxathian-2-one |
| SMILES | CO[C@@]1(C)OC(=O)CS[C@]1(C)OC |
| InChI | InChI=1S/C8H14O4S/c1-7(10-3)8(2,11-4)13-5-6(9)12-7/h5H2,1-4H3/t7-,8-/m0/s1 |
| InChIKey | SNDAQKQPUWAXAB-YUMQZZPRSA-N |
| XLogP | 1.00 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.26 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |