C16H18O4S — CID 101370858
methyl 1-(benzenesulfonyl)-3-ethenyl-4-methylidenecyclopentane-1-carboxylate (PubChem CID 101370858) has the molecular formula C16H18O4S and a molecular weight of 306.38 g/mol. Its IUPAC name is methyl 1-(benzenesulfonyl)-3-ethenyl-4-methylidenecyclopentane-1-carboxylate.
| Compound Name | methyl 1-(benzenesulfonyl)-3-ethenyl-4-methylidenecyclopentane-1-carboxylate |
|---|---|
| PubChem CID | 101370858 |
| Molecular Formula | C16H18O4S |
| Molecular Weight | 306.38 g/mol |
| Exact Mass | 306.09 |
| IUPAC Name | methyl 1-(benzenesulfonyl)-3-ethenyl-4-methylidenecyclopentane-1-carboxylate |
| SMILES | C=CC1CC(C(=O)OC)(S(=O)(=O)c2ccccc2)CC1=C |
| InChI | InChI=1S/C16H18O4S/c1-4-13-11-16(10-12(13)2,15(17)20-3)21(18,19)14-8-6-5-7-9-14/h4-9,13H,1-2,10-11H2,3H3 |
| InChIKey | MVSRZYKTFBHKOK-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.38 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|