C14H17FO3S — CID 134510858
ethyl 3-(4-fluorophenyl)sulfinylcyclopentane-1-carboxylate (PubChem CID 134510858) has the molecular formula C14H17FO3S and a molecular weight of 284.35 g/mol. Its IUPAC name is ethyl 3-(4-fluorophenyl)sulfinylcyclopentane-1-carboxylate.
| Compound Name | ethyl 3-(4-fluorophenyl)sulfinylcyclopentane-1-carboxylate |
|---|---|
| PubChem CID | 134510858 |
| Molecular Formula | C14H17FO3S |
| Molecular Weight | 284.35 g/mol |
| Exact Mass | 284.09 |
| IUPAC Name | ethyl 3-(4-fluorophenyl)sulfinylcyclopentane-1-carboxylate |
| SMILES | CCOC(=O)C1CCC(S(=O)c2ccc(F)cc2)C1 |
| InChI | InChI=1S/C14H17FO3S/c1-2-18-14(16)10-3-6-13(9-10)19(17)12-7-4-11(15)5-8-12/h4-5,7-8,10,13H,2-3,6,9H2,1H3 |
| InChIKey | VWEUQCCHWRFVBU-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.35 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |