C25H20O3 — CID 101371319
(11'S,15'R,16'S)-16'-hydroxyspiro[3,4-dihydronaphthalene-1,12'-tetracyclo[8.6.0.03,8.011,15]hexadeca-1,3,5,7,9-pentaene]-2,13'-dione (PubChem CID 101371319) has the molecular formula C25H20O3 and a molecular weight of 368.43 g/mol. Its IUPAC name is (11'S,15'R,16'S)-16'-hydroxyspiro[3,4-dihydronaphthalene-1,12'-tetracyclo[8.6.0.03,8.011,15]hexadeca-1,3,5,7,9-pentaene]-2,13'-dione.
| Compound Name | (11'S,15'R,16'S)-16'-hydroxyspiro[3,4-dihydronaphthalene-1,12'-tetracyclo[8.6.0.03,8.011,15]hexadeca-1,3,5,7,9-pentaene]-2,13'-dione |
|---|---|
| PubChem CID | 101371319 |
| Molecular Formula | C25H20O3 |
| Molecular Weight | 368.43 g/mol |
| Exact Mass | 368.14 |
| IUPAC Name | (11'S,15'R,16'S)-16'-hydroxyspiro[3,4-dihydronaphthalene-1,12'-tetracyclo[8.6.0.03,8.011,15]hexadeca-1,3,5,7,9-pentaene]-2,13'-dione |
| SMILES | O=C1CCc2ccccc2C12C(=O)C[C@H]1[C@H](O)c3cc4ccccc4cc3[C@H]12 |
| InChI | InChI=1S/C25H20O3/c26-21-10-9-14-5-3-4-8-20(14)25(21)22(27)13-19-23(25)17-11-15-6-1-2-7-16(15)12-18(17)24(19)28/h1-8,11-12,19,23-24,28H,9-10,13H2/t19-,23-,24-,25?/m1/s1 |
| InChIKey | LOKBOZDXYZCPKU-WJOYXYSLSA-N |
| XLogP | 4.01 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.43 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|