C27H36O3 — CID 101373365
(1S,2S,10S,13S,14R,19R)-1,5,10,14,18,18-hexamethylpentacyclo[11.8.0.02,10.03,8.014,19]henicosa-3(8),5-diene-4,7,17-trione (PubChem CID 101373365) has the molecular formula C27H36O3 and a molecular weight of 408.58 g/mol. Its IUPAC name is (1S,2S,10S,13S,14R,19R)-1,5,10,14,18,18-hexamethylpentacyclo[11.8.0.02,10.03,8.014,19]henicosa-3(8),5-diene-4,7,17-trione.
| Compound Name | (1S,2S,10S,13S,14R,19R)-1,5,10,14,18,18-hexamethylpentacyclo[11.8.0.02,10.03,8.014,19]henicosa-3(8),5-diene-4,7,17-trione |
|---|---|
| PubChem CID | 101373365 |
| Molecular Formula | C27H36O3 |
| Molecular Weight | 408.58 g/mol |
| Exact Mass | 408.27 |
| IUPAC Name | (1S,2S,10S,13S,14R,19R)-1,5,10,14,18,18-hexamethylpentacyclo[11.8.0.02,10.03,8.014,19]henicosa-3(8),5-diene-4,7,17-trione |
| SMILES | CC1=CC(=O)C2=C(C1=O)[C@H]1[C@@](C)(CC[C@@H]3[C@]1(C)CC[C@H]1C(C)(C)C(=O)CC[C@]31C)C2 |
| InChI | InChI=1S/C27H36O3/c1-15-13-17(28)16-14-25(4)10-7-19-26(5)12-9-20(29)24(2,3)18(26)8-11-27(19,6)23(25)21(16)22(15)30/h13,18-19,23H,7-12,14H2,1-6H3/t18-,19-,23-,25-,26-,27-/m0/s1 |
| InChIKey | AQNGTGFMADNCSF-PASJOVPISA-N |
| XLogP | 5.63 |
| TPSA | 51.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.58 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'} |
|---|