C26H36O4 — CID 155562422
(4'R,5R,8S,9S,10S,14R,17S)-4,4,4',8,10,14-hexamethylspiro[1,2,5,6,7,9,15,16-octahydrocyclopenta[a]phenanthrene-17,5'-oxolane]-2',3,11-trione (PubChem CID 155562422) has the molecular formula C26H36O4 and a molecular weight of 412.57 g/mol. Its IUPAC name is (4'R,5R,8S,9S,10S,14R,17S)-4,4,4',8,10,14-hexamethylspiro[1,2,5,6,7,9,15,16-octahydrocyclopenta[a]phenanthrene-17,5'-oxolane]-2',3,11-trione.
| Compound Name | (4'R,5R,8S,9S,10S,14R,17S)-4,4,4',8,10,14-hexamethylspiro[1,2,5,6,7,9,15,16-octahydrocyclopenta[a]phenanthrene-17,5'-oxolane]-2',3,11-trione |
|---|---|
| PubChem CID | 155562422 |
| Molecular Formula | C26H36O4 |
| Molecular Weight | 412.57 g/mol |
| Exact Mass | 412.26 |
| IUPAC Name | (4'R,5R,8S,9S,10S,14R,17S)-4,4,4',8,10,14-hexamethylspiro[1,2,5,6,7,9,15,16-octahydrocyclopenta[a]phenanthrene-17,5'-oxolane]-2',3,11-trione |
| SMILES | C[C@@H]1CC(=O)O[C@@]12CC[C@@]1(C)C2=CC(=O)[C@H]2[C@@]3(C)CCC(=O)C(C)(C)[C@@H]3CC[C@@]21C |
| InChI | InChI=1S/C26H36O4/c1-15-13-20(29)30-26(15)12-11-24(5)18(26)14-16(27)21-23(4)9-8-19(28)22(2,3)17(23)7-10-25(21,24)6/h14-15,17,21H,7-13H2,1-6H3/t15-,17+,21+,23+,24+,25+,26+/m1/s1 |
| InChIKey | TUVXZFRJBJGPCX-CVLYPPSVSA-N |
| XLogP | 5.05 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.57 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |