C32H50O3 — CID 134221748
(4aS,4bR,8aR,10aR)-7-[(1S,2S,5S)-5-acetyl-2-ethyl-2,5-dimethylcyclohexyl]-1,1,4a,8,8,8a-hexamethyl-3,4,4b,9,10,10a-hexahydrophenanthrene-2,5-dione (PubChem CID 134221748) has the molecular formula C32H50O3 and a molecular weight of 482.75 g/mol. Its IUPAC name is (4aS,4bR,8aR,10aR)-7-[(1S,2S,5S)-5-acetyl-2-ethyl-2,5-dimethylcyclohexyl]-1,1,4a,8,8,8a-hexamethyl-3,4,4b,9,10,10a-hexahydrophenanthrene-2,5-dione.
| Compound Name | (4aS,4bR,8aR,10aR)-7-[(1S,2S,5S)-5-acetyl-2-ethyl-2,5-dimethylcyclohexyl]-1,1,4a,8,8,8a-hexamethyl-3,4,4b,9,10,10a-hexahydrophenanthrene-2,5-dione |
|---|---|
| PubChem CID | 134221748 |
| Molecular Formula | C32H50O3 |
| Molecular Weight | 482.75 g/mol |
| Exact Mass | 482.38 |
| IUPAC Name | (4aS,4bR,8aR,10aR)-7-[(1S,2S,5S)-5-acetyl-2-ethyl-2,5-dimethylcyclohexyl]-1,1,4a,8,8,8a-hexamethyl-3,4,4b,9,10,10a-hexahydrophenanthrene-2,5-dione |
| SMILES | CC[C@@]1(C)CC[C@](C)(C(C)=O)C[C@@H]1C1=CC(=O)[C@@H]2[C@@]3(C)CCC(=O)C(C)(C)[C@@H]3CC[C@@]2(C)C1(C)C |
| InChI | InChI=1S/C32H50O3/c1-11-29(7)16-17-30(8,20(2)33)19-22(29)21-18-23(34)26-31(9)14-13-25(35)27(3,4)24(31)12-15-32(26,10)28(21,5)6/h18,22,24,26H,11-17,19H2,1-10H3/t22-,24+,26-,29+,30+,31+,32-/m1/s1 |
| InChIKey | NOSSBCCLIGNLCP-JLVHUWOOSA-N |
| XLogP | 7.76 |
| TPSA | 51.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.75 |
| LogP ≤ 5 | 7.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |