C28H21NOS — CID 101374813
S-(4-methylphenyl) 2-(2,2-diphenylethenylideneamino)benzenecarbothioate (PubChem CID 101374813) has the molecular formula C28H21NOS and a molecular weight of 419.55 g/mol. Its IUPAC name is S-(4-methylphenyl) 2-(2,2-diphenylethenylideneamino)benzenecarbothioate.
| Compound Name | S-(4-methylphenyl) 2-(2,2-diphenylethenylideneamino)benzenecarbothioate |
|---|---|
| PubChem CID | 101374813 |
| Molecular Formula | C28H21NOS |
| Molecular Weight | 419.55 g/mol |
| Exact Mass | 419.13 |
| IUPAC Name | S-(4-methylphenyl) 2-(2,2-diphenylethenylideneamino)benzenecarbothioate |
| SMILES | Cc1ccc(SC(=O)c2ccccc2N=C=C(c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C28H21NOS/c1-21-16-18-24(19-17-21)31-28(30)25-14-8-9-15-27(25)29-20-26(22-10-4-2-5-11-22)23-12-6-3-7-13-23/h2-19H,1H3 |
| InChIKey | OMLSTZPTWDCKFX-UHFFFAOYSA-N |
| XLogP | 7.36 |
| TPSA | 29.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.55 |
| LogP ≤ 5 | 7.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|