About S-(4-methylphenyl) 2-[(triphenyl-λ5-phosphanylidene)amino]benzenecarbothioate
S-(4-methylphenyl) 2-[(triphenyl-λ5-phosphanylidene)amino]benzenecarbothioate (PubChem CID 101374803) has the molecular formula C32H26NOPS
and a molecular weight of 503.61 g/mol. Its IUPAC name is S-(4-methylphenyl) 2-[(triphenyl-λ5-phosphanylidene)amino]benzenecarbothioate.
Molecular Properties
| Compound Name | S-(4-methylphenyl) 2-[(triphenyl-λ5-phosphanylidene)amino]benzenecarbothioate |
| PubChem CID | 101374803 |
| Molecular Formula | C32H26NOPS |
| Molecular Weight | 503.61 g/mol |
| Exact Mass | 503.15 |
| IUPAC Name | S-(4-methylphenyl) 2-[(triphenyl-λ5-phosphanylidene)amino]benzenecarbothioate |
| SMILES | Cc1ccc(SC(=O)c2ccccc2N=P(c2ccccc2)(c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C32H26NOPS/c1-25-21-23-29(24-22-25)36-32(34)30-19-11-12-20-31(30)33-35(26-13-5-2-6-14-26,27-15-7-3-8-16-27)28-17-9-4-10-18-28/h2-24H,1H3 |
| InChIKey | HQYWHQGHIDRSHR-UHFFFAOYSA-N |
| XLogP | 7.74 |
| TPSA | 29.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 503.61 |
| LogP ≤ 5 | 7.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|
Analyze S-(4-methylphenyl) 2-[(triphenyl-λ5-phosphanylidene)amino]benzenecarbothioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of S-(4-methylphenyl) 2-[(triphenyl-λ5-phosphanylidene)amino]benzenecarbothioate?
The IUPAC name of S-(4-methylphenyl) 2-[(triphenyl-λ5-phosphanylidene)amino]benzenecarbothioate (CID 101374803) is S-(4-methylphenyl) 2-[(triphenyl-λ5-phosphanylidene)amino]benzenecarbothioate.
What is the SMILES notation for S-(4-methylphenyl) 2-[(triphenyl-λ5-phosphanylidene)amino]benzenecarbothioate?
The canonical SMILES for S-(4-methylphenyl) 2-[(triphenyl-λ5-phosphanylidene)amino]benzenecarbothioate is Cc1ccc(SC(=O)c2ccccc2N=P(c2ccccc2)(c2ccccc2)c2ccccc2)cc1.
What is the InChIKey of S-(4-methylphenyl) 2-[(triphenyl-λ5-phosphanylidene)amino]benzenecarbothioate?
The InChIKey is HQYWHQGHIDRSHR-UHFFFAOYSA-N. The full InChI is InChI=1S/C32H26NOPS/c1-25-21-23-29(24-22-25)36-32(34)30-19-11-12-20-31(30)33-35(26-13-5-2-6-14-26,27-15-7-3-8-16-27)28-17-9-4-10-18-28/h2-24H,1H3.
What are the key properties of S-(4-methylphenyl) 2-[(triphenyl-λ5-phosphanylidene)amino]benzenecarbothioate?
S-(4-methylphenyl) 2-[(triphenyl-λ5-phosphanylidene)amino]benzenecarbothioate has a molecular weight of 503.61 g/mol, XLogP of 7.74, 6 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for S-(4-methylphenyl) 2-[(triphenyl-λ5-phosphanylidene)amino]benzenecarbothioate is sourced from PubChem (CID 101374803), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).