C13H9Cl2NOS — CID 2800038
S-(4-methylphenyl) 2,5-dichloropyridine-3-carbothioate (PubChem CID 2800038) has the molecular formula C13H9Cl2NOS and a molecular weight of 298.19 g/mol. Its IUPAC name is S-(4-methylphenyl) 2,5-dichloropyridine-3-carbothioate.
| Compound Name | S-(4-methylphenyl) 2,5-dichloropyridine-3-carbothioate |
|---|---|
| PubChem CID | 2800038 |
| Molecular Formula | C13H9Cl2NOS |
| Molecular Weight | 298.19 g/mol |
| Exact Mass | 296.98 |
| IUPAC Name | S-(4-methylphenyl) 2,5-dichloropyridine-3-carbothioate |
| SMILES | Cc1ccc(SC(=O)c2cc(Cl)cnc2Cl)cc1 |
| InChI | InChI=1S/C13H9Cl2NOS/c1-8-2-4-10(5-3-8)18-13(17)11-6-9(14)7-16-12(11)15/h2-7H,1H3 |
| InChIKey | YNFRFBZLYSIVLV-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 29.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.19 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|