C25H20ClNOS — CID 19648178
S-(4-methylphenyl) 2-(4-chlorophenyl)-6,8-dimethylquinoline-4-carbothioate (PubChem CID 19648178) has the molecular formula C25H20ClNOS and a molecular weight of 417.96 g/mol. Its IUPAC name is S-(4-methylphenyl) 2-(4-chlorophenyl)-6,8-dimethylquinoline-4-carbothioate.
| Compound Name | S-(4-methylphenyl) 2-(4-chlorophenyl)-6,8-dimethylquinoline-4-carbothioate |
|---|---|
| PubChem CID | 19648178 |
| Molecular Formula | C25H20ClNOS |
| Molecular Weight | 417.96 g/mol |
| Exact Mass | 417.10 |
| IUPAC Name | S-(4-methylphenyl) 2-(4-chlorophenyl)-6,8-dimethylquinoline-4-carbothioate |
| SMILES | Cc1ccc(SC(=O)c2cc(-c3ccc(Cl)cc3)nc3c(C)cc(C)cc23)cc1 |
| InChI | InChI=1S/C25H20ClNOS/c1-15-4-10-20(11-5-15)29-25(28)22-14-23(18-6-8-19(26)9-7-18)27-24-17(3)12-16(2)13-21(22)24/h4-14H,1-3H3 |
| InChIKey | DPJANDRLOSYXKD-UHFFFAOYSA-N |
| XLogP | 7.41 |
| TPSA | 29.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.96 |
| LogP ≤ 5 | 7.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|