C25H23NSi — CID 10832689
2,2-diphenyl-N-[2-(2-trimethylsilylethynyl)phenyl]ethenimine (PubChem CID 10832689) has the molecular formula C25H23NSi and a molecular weight of 365.55 g/mol. Its IUPAC name is 2,2-diphenyl-N-[2-(2-trimethylsilylethynyl)phenyl]ethenimine.
| Compound Name | 2,2-diphenyl-N-[2-(2-trimethylsilylethynyl)phenyl]ethenimine |
|---|---|
| PubChem CID | 10832689 |
| Molecular Formula | C25H23NSi |
| Molecular Weight | 365.55 g/mol |
| Exact Mass | 365.16 |
| IUPAC Name | 2,2-diphenyl-N-[2-(2-trimethylsilylethynyl)phenyl]ethenimine |
| SMILES | C[Si](C)(C)C#Cc1ccccc1N=C=C(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C25H23NSi/c1-27(2,3)19-18-23-16-10-11-17-25(23)26-20-24(21-12-6-4-7-13-21)22-14-8-5-9-15-22/h4-17H,1-3H3 |
| InChIKey | YUTBUXQCWWWXPW-UHFFFAOYSA-N |
| XLogP | 6.35 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.55 |
| LogP ≤ 5 | 6.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|