About lithium N-[bis(trimethylsilyl)methyl]-2,2-diphenylethenimine
lithium N-[bis(trimethylsilyl)methyl]-2,2-diphenylethenimine (PubChem CID 23670629) has the molecular formula C21H28LiNSi2
and a molecular weight of 357.57 g/mol. Its IUPAC name is lithium N-[bis(trimethylsilyl)methyl]-2,2-diphenylethenimine.
Molecular Properties
| Compound Name | lithium N-[bis(trimethylsilyl)methyl]-2,2-diphenylethenimine |
| PubChem CID | 23670629 |
| Molecular Formula | C21H28LiNSi2 |
| Molecular Weight | 357.57 g/mol |
| Exact Mass | 357.19 |
| IUPAC Name | lithium N-[bis(trimethylsilyl)methyl]-2,2-diphenylethenimine |
| SMILES | C[Si](C)(C)[C-](N=C=C(c1ccccc1)c1ccccc1)[Si](C)(C)C.[Li+] |
| InChI | InChI=1S/C21H28NSi2.Li/c1-23(2,3)21(24(4,5)6)22-17-20(18-13-9-7-10-14-18)19-15-11-8-12-16-19;/h7-16H,1-6H3;/q-1;+1 |
| InChIKey | PHISNSHLKOTBFK-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 357.57 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze lithium N-[bis(trimethylsilyl)methyl]-2,2-diphenylethenimine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of lithium N-[bis(trimethylsilyl)methyl]-2,2-diphenylethenimine?
The IUPAC name of lithium N-[bis(trimethylsilyl)methyl]-2,2-diphenylethenimine (CID 23670629) is lithium N-[bis(trimethylsilyl)methyl]-2,2-diphenylethenimine.
What is the SMILES notation for lithium N-[bis(trimethylsilyl)methyl]-2,2-diphenylethenimine?
The canonical SMILES for lithium N-[bis(trimethylsilyl)methyl]-2,2-diphenylethenimine is C[Si](C)(C)[C-](N=C=C(c1ccccc1)c1ccccc1)[Si](C)(C)C.[Li+].
What is the InChIKey of lithium N-[bis(trimethylsilyl)methyl]-2,2-diphenylethenimine?
The InChIKey is PHISNSHLKOTBFK-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H28NSi2.Li/c1-23(2,3)21(24(4,5)6)22-17-20(18-13-9-7-10-14-18)19-15-11-8-12-16-19;/h7-16H,1-6H3;/q-1;+1.
What are the key properties of lithium N-[bis(trimethylsilyl)methyl]-2,2-diphenylethenimine?
lithium N-[bis(trimethylsilyl)methyl]-2,2-diphenylethenimine has a molecular weight of 357.57 g/mol, XLogP of 3.08, 5 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for lithium N-[bis(trimethylsilyl)methyl]-2,2-diphenylethenimine is sourced from PubChem (CID 23670629), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).