C21H28LiNSi2 — CID 23670629
lithium N-[bis(trimethylsilyl)methyl]-2,2-diphenylethenimine (PubChem CID 23670629) has the molecular formula C21H28LiNSi2 and a molecular weight of 357.57 g/mol. Its IUPAC name is lithium N-[bis(trimethylsilyl)methyl]-2,2-diphenylethenimine.
| Compound Name | lithium N-[bis(trimethylsilyl)methyl]-2,2-diphenylethenimine |
|---|---|
| PubChem CID | 23670629 |
| Molecular Formula | C21H28LiNSi2 |
| Molecular Weight | 357.57 g/mol |
| Exact Mass | 357.19 |
| IUPAC Name | lithium N-[bis(trimethylsilyl)methyl]-2,2-diphenylethenimine |
| SMILES | C[Si](C)(C)[C-](N=C=C(c1ccccc1)c1ccccc1)[Si](C)(C)C.[Li+] |
| InChI | InChI=1S/C21H28NSi2.Li/c1-23(2,3)21(24(4,5)6)22-17-20(18-13-9-7-10-14-18)19-15-11-8-12-16-19;/h7-16H,1-6H3;/q-1;+1 |
| InChIKey | PHISNSHLKOTBFK-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.57 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|