C31H28N2 — CID 102370349
N-[(S)-[2-(2,2-diphenylethenylideneamino)phenyl]-phenylmethyl]-2-methylpropan-1-imine (PubChem CID 102370349) has the molecular formula C31H28N2 and a molecular weight of 428.58 g/mol. Its IUPAC name is N-[(S)-[2-(2,2-diphenylethenylideneamino)phenyl]-phenylmethyl]-2-methylpropan-1-imine.
| Compound Name | N-[(S)-[2-(2,2-diphenylethenylideneamino)phenyl]-phenylmethyl]-2-methylpropan-1-imine |
|---|---|
| PubChem CID | 102370349 |
| Molecular Formula | C31H28N2 |
| Molecular Weight | 428.58 g/mol |
| Exact Mass | 428.23 |
| IUPAC Name | N-[(S)-[2-(2,2-diphenylethenylideneamino)phenyl]-phenylmethyl]-2-methylpropan-1-imine |
| SMILES | CC(C)/C=N/[C@@H](c1ccccc1)c1ccccc1N=C=C(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C31H28N2/c1-24(2)22-33-31(27-18-10-5-11-19-27)28-20-12-13-21-30(28)32-23-29(25-14-6-3-7-15-25)26-16-8-4-9-17-26/h3-22,24,31H,1-2H3/b33-22+/t31-/m0/s1 |
| InChIKey | FYRAMHHYQSCACD-DSWPHNCVSA-N |
| XLogP | 7.94 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.58 |
| LogP ≤ 5 | 7.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|