C16H11N — CID 140945321
N-ethynyl-2,2-diphenylethenimine (PubChem CID 140945321) has the molecular formula C16H11N and a molecular weight of 217.27 g/mol. Its IUPAC name is N-ethynyl-2,2-diphenylethenimine.
| Compound Name | N-ethynyl-2,2-diphenylethenimine |
|---|---|
| PubChem CID | 140945321 |
| Molecular Formula | C16H11N |
| Molecular Weight | 217.27 g/mol |
| Exact Mass | 217.09 |
| IUPAC Name | N-ethynyl-2,2-diphenylethenimine |
| SMILES | C#CN=C=C(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C16H11N/c1-2-17-13-16(14-9-5-3-6-10-14)15-11-7-4-8-12-15/h1,3-12H |
| InChIKey | UFKRMQYGOWOTOS-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.27 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|