About (2-oxo-1-phenylethenyl) hypochlorite
(2-oxo-1-phenylethenyl) hypochlorite (PubChem CID 86622261) has the molecular formula C8H5ClO2
and a molecular weight of 168.58 g/mol. Its IUPAC name is (2-oxo-1-phenylethenyl) hypochlorite.
Molecular Properties
| Compound Name | (2-oxo-1-phenylethenyl) hypochlorite |
| PubChem CID | 86622261 |
| Molecular Formula | C8H5ClO2 |
| Molecular Weight | 168.58 g/mol |
| Exact Mass | 168.00 |
| IUPAC Name | (2-oxo-1-phenylethenyl) hypochlorite |
| SMILES | O=C=C(OCl)c1ccccc1 |
| InChI | InChI=1S/C8H5ClO2/c9-11-8(6-10)7-4-2-1-3-5-7/h1-5H |
| InChIKey | JLKMAPQOZWYSQD-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 168.58 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'ketene', 'substructure': 'N/A'} |
|---|
Analyze (2-oxo-1-phenylethenyl) hypochlorite with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-oxo-1-phenylethenyl) hypochlorite?
The IUPAC name of (2-oxo-1-phenylethenyl) hypochlorite (CID 86622261) is (2-oxo-1-phenylethenyl) hypochlorite.
What is the SMILES notation for (2-oxo-1-phenylethenyl) hypochlorite?
The canonical SMILES for (2-oxo-1-phenylethenyl) hypochlorite is O=C=C(OCl)c1ccccc1.
What is the InChIKey of (2-oxo-1-phenylethenyl) hypochlorite?
The InChIKey is JLKMAPQOZWYSQD-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H5ClO2/c9-11-8(6-10)7-4-2-1-3-5-7/h1-5H.
What are the key properties of (2-oxo-1-phenylethenyl) hypochlorite?
(2-oxo-1-phenylethenyl) hypochlorite has a molecular weight of 168.58 g/mol, XLogP of 2.03, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2-oxo-1-phenylethenyl) hypochlorite is sourced from PubChem (CID 86622261), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).