About 2-phenylbuta-1,3-diene-1,4-dione
2-phenylbuta-1,3-diene-1,4-dione (PubChem CID 86181605) has the molecular formula C10H6O2
and a molecular weight of 158.16 g/mol. Its IUPAC name is 2-phenylbuta-1,3-diene-1,4-dione.
Molecular Properties
| Compound Name | 2-phenylbuta-1,3-diene-1,4-dione |
| PubChem CID | 86181605 |
| Molecular Formula | C10H6O2 |
| Molecular Weight | 158.16 g/mol |
| Exact Mass | 158.04 |
| IUPAC Name | 2-phenylbuta-1,3-diene-1,4-dione |
| SMILES | O=C=CC(=C=O)c1ccccc1 |
| InChI | InChI=1S/C10H6O2/c11-7-6-10(8-12)9-4-2-1-3-5-9/h1-6H |
| InChIKey | DUJCHUUPEZRDOK-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 158.16 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'ketene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze 2-phenylbuta-1,3-diene-1,4-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-phenylbuta-1,3-diene-1,4-dione?
The IUPAC name of 2-phenylbuta-1,3-diene-1,4-dione (CID 86181605) is 2-phenylbuta-1,3-diene-1,4-dione.
What is the SMILES notation for 2-phenylbuta-1,3-diene-1,4-dione?
The canonical SMILES for 2-phenylbuta-1,3-diene-1,4-dione is O=C=CC(=C=O)c1ccccc1.
What is the InChIKey of 2-phenylbuta-1,3-diene-1,4-dione?
The InChIKey is DUJCHUUPEZRDOK-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H6O2/c11-7-6-10(8-12)9-4-2-1-3-5-9/h1-6H.
What are the key properties of 2-phenylbuta-1,3-diene-1,4-dione?
2-phenylbuta-1,3-diene-1,4-dione has a molecular weight of 158.16 g/mol, XLogP of 1.29, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-phenylbuta-1,3-diene-1,4-dione is sourced from PubChem (CID 86181605), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).