C15H11NO — CID 11447363
3-imino-2,3-diphenylprop-1-en-1-one (PubChem CID 11447363) has the molecular formula C15H11NO and a molecular weight of 221.26 g/mol. Its IUPAC name is 3-imino-2,3-diphenylprop-1-en-1-one.
| Compound Name | 3-imino-2,3-diphenylprop-1-en-1-one |
|---|---|
| PubChem CID | 11447363 |
| Molecular Formula | C15H11NO |
| Molecular Weight | 221.26 g/mol |
| Exact Mass | 221.08 |
| IUPAC Name | 3-imino-2,3-diphenylprop-1-en-1-one |
| SMILES | [H]/N=C(/C(=C=O)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C15H11NO/c16-15(13-9-5-2-6-10-13)14(11-17)12-7-3-1-4-8-12/h1-10,16H/b16-15+ |
| InChIKey | ZHZCRFFJSYNLNN-FOCLMDBBSA-N |
| XLogP | 2.97 |
| TPSA | 40.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.26 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'ketene', 'substructure': 'N/A'} |
|---|