C12H24OSi2 — CID 101375060
1,6-bis(trimethylsilyl)hex-5-yn-1-one (PubChem CID 101375060) has the molecular formula C12H24OSi2 and a molecular weight of 240.49 g/mol. Its IUPAC name is 1,6-bis(trimethylsilyl)hex-5-yn-1-one.
| Compound Name | 1,6-bis(trimethylsilyl)hex-5-yn-1-one |
|---|---|
| PubChem CID | 101375060 |
| Molecular Formula | C12H24OSi2 |
| Molecular Weight | 240.49 g/mol |
| Exact Mass | 240.14 |
| IUPAC Name | 1,6-bis(trimethylsilyl)hex-5-yn-1-one |
| SMILES | C[Si](C)(C)C#CCCCC(=O)[Si](C)(C)C |
| InChI | InChI=1S/C12H24OSi2/c1-14(2,3)11-9-7-8-10-12(13)15(4,5)6/h7-8,10H2,1-6H3 |
| InChIKey | OVXUODPXOJGGMJ-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.49 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|