C17H30OSi2 — CID 134997995
8-triethylsilyl-1-trimethylsilylocta-5,7-diyn-2-one (PubChem CID 134997995) has the molecular formula C17H30OSi2 and a molecular weight of 306.60 g/mol. Its IUPAC name is 8-triethylsilyl-1-trimethylsilylocta-5,7-diyn-2-one.
| Compound Name | 8-triethylsilyl-1-trimethylsilylocta-5,7-diyn-2-one |
|---|---|
| PubChem CID | 134997995 |
| Molecular Formula | C17H30OSi2 |
| Molecular Weight | 306.60 g/mol |
| Exact Mass | 306.18 |
| IUPAC Name | 8-triethylsilyl-1-trimethylsilylocta-5,7-diyn-2-one |
| SMILES | CC[Si](C#CC#CCCC(=O)C[Si](C)(C)C)(CC)CC |
| InChI | InChI=1S/C17H30OSi2/c1-7-20(8-2,9-3)15-13-11-10-12-14-17(18)16-19(4,5)6/h7-9,12,14,16H2,1-6H3 |
| InChIKey | NIKNWGCPGJWBDU-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.60 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|