C23H42OSi2 — CID 10475528
1,5-bis[tri(propan-2-yl)silyl]penta-1,4-diyn-3-one (PubChem CID 10475528) has the molecular formula C23H42OSi2 and a molecular weight of 390.76 g/mol. Its IUPAC name is 1,5-bis[tri(propan-2-yl)silyl]penta-1,4-diyn-3-one.
| Compound Name | 1,5-bis[tri(propan-2-yl)silyl]penta-1,4-diyn-3-one |
|---|---|
| PubChem CID | 10475528 |
| Molecular Formula | C23H42OSi2 |
| Molecular Weight | 390.76 g/mol |
| Exact Mass | 390.28 |
| IUPAC Name | 1,5-bis[tri(propan-2-yl)silyl]penta-1,4-diyn-3-one |
| SMILES | CC(C)[Si](C#CC(=O)C#C[Si](C(C)C)(C(C)C)C(C)C)(C(C)C)C(C)C |
| InChI | InChI=1S/C23H42OSi2/c1-17(2)25(18(3)4,19(5)6)15-13-23(24)14-16-26(20(7)8,21(9)10)22(11)12/h17-22H,1-12H3 |
| InChIKey | INQDVAXBZKSIHY-UHFFFAOYSA-N |
| XLogP | 7.00 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.76 |
| LogP ≤ 5 | 7.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'ene_one_yne_A(1)', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|