C22H23NO2 — CID 101375313
2,2-diphenyl-7-propyl-5,6-dihydro-3H-furo[2,3-b]pyridin-4-one (PubChem CID 101375313) has the molecular formula C22H23NO2 and a molecular weight of 333.43 g/mol. Its IUPAC name is 2,2-diphenyl-7-propyl-5,6-dihydro-3H-furo[2,3-b]pyridin-4-one.
| Compound Name | 2,2-diphenyl-7-propyl-5,6-dihydro-3H-furo[2,3-b]pyridin-4-one |
|---|---|
| PubChem CID | 101375313 |
| Molecular Formula | C22H23NO2 |
| Molecular Weight | 333.43 g/mol |
| Exact Mass | 333.17 |
| IUPAC Name | 2,2-diphenyl-7-propyl-5,6-dihydro-3H-furo[2,3-b]pyridin-4-one |
| SMILES | CCCN1CCC(=O)C2=C1OC(c1ccccc1)(c1ccccc1)C2 |
| InChI | InChI=1S/C22H23NO2/c1-2-14-23-15-13-20(24)19-16-22(25-21(19)23,17-9-5-3-6-10-17)18-11-7-4-8-12-18/h3-12H,2,13-16H2,1H3 |
| InChIKey | DYIARFLJHWDEAH-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.43 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |