C14H17FO2 — CID 101376802
trans-(1R,2S)-2-fluoro-1-(4-methoxyphenyl)cyclohexane-1-carbaldehyde (PubChem CID 101376802) has the molecular formula C14H17FO2 and a molecular weight of 236.29 g/mol. Its IUPAC name is trans-(1R,2S)-2-fluoro-1-(4-methoxyphenyl)cyclohexane-1-carbaldehyde.
| Compound Name | trans-(1R,2S)-2-fluoro-1-(4-methoxyphenyl)cyclohexane-1-carbaldehyde |
|---|---|
| PubChem CID | 101376802 |
| Molecular Formula | C14H17FO2 |
| Molecular Weight | 236.29 g/mol |
| Exact Mass | 236.12 |
| IUPAC Name | trans-(1R,2S)-2-fluoro-1-(4-methoxyphenyl)cyclohexane-1-carbaldehyde |
| SMILES | COc1ccc([C@@]2(C=O)CCCC[C@@H]2F)cc1 |
| InChI | InChI=1S/C14H17FO2/c1-17-12-7-5-11(6-8-12)14(10-16)9-3-2-4-13(14)15/h5-8,10,13H,2-4,9H2,1H3/t13-,14-/m0/s1 |
| InChIKey | RXYGKBCORRIPHH-KBPBESRZSA-N |
| XLogP | 3.04 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.29 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|