About 1-methoxy-4-(1,2,2-trimethylcyclopentyl)benzene
1-methoxy-4-(1,2,2-trimethylcyclopentyl)benzene (PubChem CID 11252954) has the molecular formula C15H22O
and a molecular weight of 218.34 g/mol. Its IUPAC name is 1-methoxy-4-(1,2,2-trimethylcyclopentyl)benzene.
Molecular Properties
| Compound Name | 1-methoxy-4-(1,2,2-trimethylcyclopentyl)benzene |
| PubChem CID | 11252954 |
| Molecular Formula | C15H22O |
| Molecular Weight | 218.34 g/mol |
| Exact Mass | 218.17 |
| IUPAC Name | 1-methoxy-4-(1,2,2-trimethylcyclopentyl)benzene |
| SMILES | COc1ccc(C2(C)CCCC2(C)C)cc1 |
| InChI | InChI=1S/C15H22O/c1-14(2)10-5-11-15(14,3)12-6-8-13(16-4)9-7-12/h6-9H,5,10-11H2,1-4H3 |
| InChIKey | YLRGJQAILGTUJP-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 218.34 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1-methoxy-4-(1,2,2-trimethylcyclopentyl)benzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methoxy-4-(1,2,2-trimethylcyclopentyl)benzene?
The IUPAC name of 1-methoxy-4-(1,2,2-trimethylcyclopentyl)benzene (CID 11252954) is 1-methoxy-4-(1,2,2-trimethylcyclopentyl)benzene.
What is the SMILES notation for 1-methoxy-4-(1,2,2-trimethylcyclopentyl)benzene?
The canonical SMILES for 1-methoxy-4-(1,2,2-trimethylcyclopentyl)benzene is COc1ccc(C2(C)CCCC2(C)C)cc1.
What is the InChIKey of 1-methoxy-4-(1,2,2-trimethylcyclopentyl)benzene?
The InChIKey is YLRGJQAILGTUJP-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H22O/c1-14(2)10-5-11-15(14,3)12-6-8-13(16-4)9-7-12/h6-9H,5,10-11H2,1-4H3.
What are the key properties of 1-methoxy-4-(1,2,2-trimethylcyclopentyl)benzene?
1-methoxy-4-(1,2,2-trimethylcyclopentyl)benzene has a molecular weight of 218.34 g/mol, XLogP of 4.16, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methoxy-4-(1,2,2-trimethylcyclopentyl)benzene is sourced from PubChem (CID 11252954), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).