C18H15N3O4 — CID 101377592
[(2S)-4-diazo-3-oxo-1-phenylbutan-2-yl]carbamoyl benzoate (PubChem CID 101377592) has the molecular formula C18H15N3O4 and a molecular weight of 337.34 g/mol. Its IUPAC name is [(2S)-4-diazo-3-oxo-1-phenylbutan-2-yl]carbamoyl benzoate.
| Compound Name | [(2S)-4-diazo-3-oxo-1-phenylbutan-2-yl]carbamoyl benzoate |
|---|---|
| PubChem CID | 101377592 |
| Molecular Formula | C18H15N3O4 |
| Molecular Weight | 337.34 g/mol |
| Exact Mass | 337.11 |
| IUPAC Name | [(2S)-4-diazo-3-oxo-1-phenylbutan-2-yl]carbamoyl benzoate |
| SMILES | [N-]=[N+]=CC(=O)[C@H](Cc1ccccc1)NC(=O)OC(=O)c1ccccc1 |
| InChI | InChI=1S/C18H15N3O4/c19-20-12-16(22)15(11-13-7-3-1-4-8-13)21-18(24)25-17(23)14-9-5-2-6-10-14/h1-10,12,15H,11H2,(H,21,24)/t15-/m0/s1 |
| InChIKey | PDQRULYXSARSCW-HNNXBMFYSA-N |
| XLogP | 2.03 |
| TPSA | 108.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.34 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|