C29H36BrN3O3 — CID 101380321
N-[(2S)-1-[[(2S)-1-[(3-bromophenyl)methylamino]-4-methyl-1-oxopentan-2-yl]amino]-1-oxo-3-phenylpropan-2-yl]hept-6-ynamide (PubChem CID 101380321) has the molecular formula C29H36BrN3O3 and a molecular weight of 554.53 g/mol. Its IUPAC name is N-[(2S)-1-[[(2S)-1-[(3-bromophenyl)methylamino]-4-methyl-1-oxopentan-2-yl]amino]-1-oxo-3-phenylpropan-2-yl]hept-6-ynamide.
| Compound Name | N-[(2S)-1-[[(2S)-1-[(3-bromophenyl)methylamino]-4-methyl-1-oxopentan-2-yl]amino]-1-oxo-3-phenylpropan-2-yl]hept-6-ynamide |
|---|---|
| PubChem CID | 101380321 |
| Molecular Formula | C29H36BrN3O3 |
| Molecular Weight | 554.53 g/mol |
| Exact Mass | 553.19 |
| IUPAC Name | N-[(2S)-1-[[(2S)-1-[(3-bromophenyl)methylamino]-4-methyl-1-oxopentan-2-yl]amino]-1-oxo-3-phenylpropan-2-yl]hept-6-ynamide |
| SMILES | C#CCCCCC(=O)N[C@@H](Cc1ccccc1)C(=O)N[C@@H](CC(C)C)C(=O)NCc1cccc(Br)c1 |
| InChI | InChI=1S/C29H36BrN3O3/c1-4-5-6-10-16-27(34)32-26(19-22-12-8-7-9-13-22)29(36)33-25(17-21(2)3)28(35)31-20-23-14-11-15-24(30)18-23/h1,7-9,11-15,18,21,25-26H,5-6,10,16-17,19-20H2,2-3H3,(H,31,35)(H,32,34)(H,33,36)/t25-,26-/m0/s1 |
| InChIKey | OEOAEMXNTHKFDT-UIOOFZCWSA-N |
| XLogP | 4.52 |
| TPSA | 87.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.53 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|