C26H36N4O4 — CID 102178832
(2S)-4-methyl-N-[(2S)-1-oxo-1-(prop-2-enylamino)propan-2-yl]-2-[[(2S)-2-(pent-4-ynoylamino)-3-phenylpropanoyl]amino]pentanamide (PubChem CID 102178832) has the molecular formula C26H36N4O4 and a molecular weight of 468.60 g/mol. Its IUPAC name is (2S)-4-methyl-N-[(2S)-1-oxo-1-(prop-2-enylamino)propan-2-yl]-2-[[(2S)-2-(pent-4-ynoylamino)-3-phenylpropanoyl]amino]pentanamide.
| Compound Name | (2S)-4-methyl-N-[(2S)-1-oxo-1-(prop-2-enylamino)propan-2-yl]-2-[[(2S)-2-(pent-4-ynoylamino)-3-phenylpropanoyl]amino]pentanamide |
|---|---|
| PubChem CID | 102178832 |
| Molecular Formula | C26H36N4O4 |
| Molecular Weight | 468.60 g/mol |
| Exact Mass | 468.27 |
| IUPAC Name | (2S)-4-methyl-N-[(2S)-1-oxo-1-(prop-2-enylamino)propan-2-yl]-2-[[(2S)-2-(pent-4-ynoylamino)-3-phenylpropanoyl]amino]pentanamide |
| SMILES | C#CCCC(=O)N[C@@H](Cc1ccccc1)C(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](C)C(=O)NCC=C |
| InChI | InChI=1S/C26H36N4O4/c1-6-8-14-23(31)29-22(17-20-12-10-9-11-13-20)26(34)30-21(16-18(3)4)25(33)28-19(5)24(32)27-15-7-2/h1,7,9-13,18-19,21-22H,2,8,14-17H2,3-5H3,(H,27,32)(H,28,33)(H,29,31)(H,30,34)/t19-,21-,22-/m0/s1 |
| InChIKey | YYDYDCWDIJUBKN-BVSLBCMMSA-N |
| XLogP | 1.47 |
| TPSA | 116.40 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.60 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|