C15H19N3O2S — CID 101381241
3,8,8-trimethyl-2-methylsulfanyl-5,7,9,10-tetrahydropyrimido[4,5-b]quinoline-4,6-dione (PubChem CID 101381241) has the molecular formula C15H19N3O2S and a molecular weight of 305.40 g/mol. Its IUPAC name is 3,8,8-trimethyl-2-methylsulfanyl-5,7,9,10-tetrahydropyrimido[4,5-b]quinoline-4,6-dione.
| Compound Name | 3,8,8-trimethyl-2-methylsulfanyl-5,7,9,10-tetrahydropyrimido[4,5-b]quinoline-4,6-dione |
|---|---|
| PubChem CID | 101381241 |
| Molecular Formula | C15H19N3O2S |
| Molecular Weight | 305.40 g/mol |
| Exact Mass | 305.12 |
| IUPAC Name | 3,8,8-trimethyl-2-methylsulfanyl-5,7,9,10-tetrahydropyrimido[4,5-b]quinoline-4,6-dione |
| SMILES | CSc1nc2c(c(=O)n1C)CC1=C(CC(C)(C)CC1=O)N2 |
| InChI | InChI=1S/C15H19N3O2S/c1-15(2)6-10-8(11(19)7-15)5-9-12(16-10)17-14(21-4)18(3)13(9)20/h16H,5-7H2,1-4H3 |
| InChIKey | GMBXBFTYPMMJOA-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 63.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.40 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |