C12H17NO2 — CID 4210238
3,7,7-trimethyl-3,4,6,8-tetrahydro-1H-quinoline-2,5-dione (PubChem CID 4210238) has the molecular formula C12H17NO2 and a molecular weight of 207.27 g/mol. Its IUPAC name is 3,7,7-trimethyl-3,4,6,8-tetrahydro-1H-quinoline-2,5-dione.
| Compound Name | 3,7,7-trimethyl-3,4,6,8-tetrahydro-1H-quinoline-2,5-dione |
|---|---|
| PubChem CID | 4210238 |
| Molecular Formula | C12H17NO2 |
| Molecular Weight | 207.27 g/mol |
| Exact Mass | 207.13 |
| IUPAC Name | 3,7,7-trimethyl-3,4,6,8-tetrahydro-1H-quinoline-2,5-dione |
| SMILES | CC1CC2=C(CC(C)(C)CC2=O)NC1=O |
| InChI | InChI=1S/C12H17NO2/c1-7-4-8-9(13-11(7)15)5-12(2,3)6-10(8)14/h7H,4-6H2,1-3H3,(H,13,15) |
| InChIKey | VCCAWNRYADWUIY-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.27 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |