C11H16N2O2 — CID 15322685
3,6,6-trimethyl-3,4,5,7-tetrahydro-1H-quinoxaline-2,8-dione (PubChem CID 15322685) has the molecular formula C11H16N2O2 and a molecular weight of 208.26 g/mol. Its IUPAC name is 3,6,6-trimethyl-3,4,5,7-tetrahydro-1H-quinoxaline-2,8-dione.
| Compound Name | 3,6,6-trimethyl-3,4,5,7-tetrahydro-1H-quinoxaline-2,8-dione |
|---|---|
| PubChem CID | 15322685 |
| Molecular Formula | C11H16N2O2 |
| Molecular Weight | 208.26 g/mol |
| Exact Mass | 208.12 |
| IUPAC Name | 3,6,6-trimethyl-3,4,5,7-tetrahydro-1H-quinoxaline-2,8-dione |
| SMILES | CC1NC2=C(NC1=O)C(=O)CC(C)(C)C2 |
| InChI | InChI=1S/C11H16N2O2/c1-6-10(15)13-9-7(12-6)4-11(2,3)5-8(9)14/h6,12H,4-5H2,1-3H3,(H,13,15) |
| InChIKey | ANLAZDFRFWYRTK-UHFFFAOYSA-N |
| XLogP | 0.69 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.26 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |